| MolName | 2-(2,5-dichlorophenoxy)-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide |
| MolecularFormula | C19H14N2O2Cl2 |
| Smiles | O=C(COc(cc(cc1)Cl)c1Cl)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C19H14Cl2N2O2/c20-15-8-9-17(21)18(10-15)25-12-19(24)23-22-11-14-6-3-5-13-4-1-2-7-16(13)14/h1-11H,12H2,(H,23,24) |
| InChIK | VZRZMWSWVRDDLR-UHFFFAOYSA-N |
| TotalMolweight | 373.238 |
| Molweight | 373.238 |
| MonoisotopicMass | 372.043232 |
| CLogP | 5.1829 |
| CLogS | -6.579 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 276.19 |
| Relative PSA | 0.16659 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 4.2278 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2,5-dichlorophenoxy)-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide | 2 - 2-(2,5-dichlorophenoxy)-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide