| MolName | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(4-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C19H18N6O4 |
| Smiles | O=C(CNC(C(N1)=O)=NNC1=O)N/N=C/c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C19H18N6O4/c26-16(11-20-17-18(27)22-19(28)25-24-17)23-21-10-13-6-8-15(9-7-13)29-12-14-4-2-1-3-5-14/h1-10H,11-12H2,(H,20,24)(H,23,26)(H2,22,25,27,28) |
| InChIK | VZUCVUOXXYJANY-UHFFFAOYSA-N |
| TotalMolweight | 394.39 |
| Molweight | 394.39 |
| MonoisotopicMass | 394.138954 |
| CLogP | 0.6927 |
| CLogS | -4.277 |
| H Acceptors | 10 |
| H Donors | 4 |
| TotalSurfaceArea | 303.86 |
| Relative PSA | 0.38827 |
| PolarSurfaceArea | 133.28 |
| Druglikeness | 6.5802 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72414 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(4-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(4-phenylmethoxyphenyl)methylideneamino]acetamide