| MolName | 4-N-(4-fluorophenyl)-2-N-[(Z)-[5-nitro-2,4-di(piperidin-1-yl)phenyl]methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C31H39N10O2F |
| Smiles | [O-][N+](c(c(N1CCCCC1)c1)cc(/C=N\Nc2nc(Nc(cc3)ccc3F)nc(N3CCCCC3)n2)c1N1CCCCC1)=O |
| InChI | InChI=1S/C31H39FN10O2/c32-24-10-12-25(13-11-24)34-29-35-30(37-31(36-29)41-18-8-3-9-19-41)38-33-22-23-20-28(42(43)44)27(40-16-6-2-7-17-40)21-26(23)39-14-4-1-5-15-39/h10-13,20-22H,1-9,14-19H2,(H2,34,35,36,37,38) |
| InChIK | WAFDFOHVGLFHAD-UHFFFAOYSA-N |
| TotalMolweight | 602.717 |
| Molweight | 602.717 |
| MonoisotopicMass | 602.324148 |
| CLogP | 6.9599 |
| CLogS | -8.663 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 463.56 |
| Relative PSA | 0.23386 |
| PolarSurfaceArea | 130.63 |
| Druglikeness | -3.7235 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.45455 |
| Fragments | 1 |
| Non HAtoms | 44 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 18 |
| Symmetricatoms | 8 |
| Amines | 2 |
| Aromatic Amines | 2 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-(4-fluorophenyl)-2-N-[(Z)-[5-nitro-2,4-di(piperidin-1-yl)phenyl]methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 4-N-(4-fluorophenyl)-2-N-[(Z)-[5-nitro-2,4-di(piperidin-1-yl)phenyl]methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine