| MolName | N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-1,2,4-triazol-4-yliminomethyl]indol-1-yl]acetamide |
| MolecularFormula | C20H16N6O3 |
| Smiles | O=C(Cn1c(cccc2)c2c(/C=N\n2cnnc2)c1)Nc(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C20H16N6O3/c27-20(24-15-5-6-18-19(7-15)29-13-28-18)10-25-9-14(8-23-26-11-21-22-12-26)16-3-1-2-4-17(16)25/h1-9,11-12H,10,13H2,(H,24,27) |
| InChIK | WAFZUFYLKGFMDT-UHFFFAOYSA-N |
| TotalMolweight | 388.386 |
| Molweight | 388.386 |
| MonoisotopicMass | 388.128389 |
| CLogP | 2.154 |
| CLogS | -6.188 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 291.29 |
| Relative PSA | 0.31477 |
| PolarSurfaceArea | 95.56 |
| Druglikeness | 6.0515 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-1,2,4-triazol-4-yliminomethyl]indol-1-yl]acetamide | 2 - N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-1,2,4-triazol-4-yliminomethyl]indol-1-yl]acetamide