| MolName | 4-amino-N-[(Z)-thiophen-3-ylmethylideneamino]benzamide |
| MolecularFormula | C12H11N3OS |
| Smiles | Nc(cc1)ccc1C(N/N=C\c1cscc1)=O |
| InChI | InChI=1S/C12H11N3OS/c13-11-3-1-10(2-4-11)12(16)15-14-7-9-5-6-17-8-9/h1-8H,13H2,(H,15,16) |
| InChIK | WAHPMWSWFTVTLB-UHFFFAOYSA-N |
| TotalMolweight | 245.305 |
| Molweight | 245.305 |
| MonoisotopicMass | 245.062282 |
| CLogP | 2.3087 |
| CLogS | -3.697 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 191.45 |
| Relative PSA | 0.3742 |
| PolarSurfaceArea | 95.72 |
| Druglikeness | 4.8722 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-thiophen-3-ylmethylideneamino]benzamide | 2 - 4-amino-N-[(Z)-thiophen-3-ylmethylideneamino]benzamide