| MolName | [2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| MolecularFormula | C21H16N2O5Cl2S |
| Smiles | O=C(COc(cc1)ccc1Cl)N/N=C\c(cccc1)c1OS(c(cc1)ccc1Cl)(=O)=O |
| InChI | InChI=1S/C21H16Cl2N2O5S/c22-16-5-9-18(10-6-16)29-14-21(26)25-24-13-15-3-1-2-4-20(15)30-31(27,28)19-11-7-17(23)8-12-19/h1-13H,14H2,(H,25,26) |
| InChIK | WAPCYIMHAXRMHR-UHFFFAOYSA-N |
| TotalMolweight | 479.339 |
| Molweight | 479.339 |
| MonoisotopicMass | 478.015697 |
| CLogP | 4.8674 |
| CLogS | -5.747 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 339.93 |
| Relative PSA | 0.24885 |
| PolarSurfaceArea | 102.44 |
| Druglikeness | 6.0282 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64516 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate | 2 - [2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate