| MolName | N-[5-[2-[(2Z)-2-[[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
| MolecularFormula | C27H20N5O4ClS |
| Smiles | O=C(Cc1nnc(NC(c2ccco2)=O)s1)N/N=C\c(cc(cc1)Cl)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C27H20ClN5O4S/c28-20-10-11-22(37-16-18-7-3-6-17-5-1-2-8-21(17)18)19(13-20)15-29-31-24(34)14-25-32-33-27(38-25)30-26(35)23-9-4-12-36-23/h1-13,15H,14,16H2,(H,31,34)(H,30,33,35) |
| InChIK | WBBKLNFWTXPLOU-UHFFFAOYSA-N |
| TotalMolweight | 546.006 |
| Molweight | 546.006 |
| MonoisotopicMass | 545.092452 |
| CLogP | 5.5274 |
| CLogS | -7.77 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 406.41 |
| Relative PSA | 0.3123 |
| PolarSurfaceArea | 146.95 |
| Druglikeness | 6.5644 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 3 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-[(2Z)-2-[[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide | 2 - N-[5-[2-[(2Z)-2-[[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide