| MolName | 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C19H13N4O7Br |
| Smiles | [O-][N+](c1cccc(-c2ccc(/C=N\NC(COc(ccc([N+]([O-])=O)c3)c3Br)=O)o2)c1)=O |
| InChI | InChI=1S/C19H13BrN4O7/c20-16-9-14(24(28)29)4-6-18(16)30-11-19(25)22-21-10-15-5-7-17(31-15)12-2-1-3-13(8-12)23(26)27/h1-10H,11H2,(H,22,25) |
| InChIK | WBBXJDFSYNRJPJ-UHFFFAOYSA-N |
| TotalMolweight | 489.237 |
| Molweight | 489.237 |
| MonoisotopicMass | 487.996762 |
| CLogP | 2.5974 |
| CLogS | -6.715 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 326.17 |
| Relative PSA | 0.37085 |
| PolarSurfaceArea | 155.47 |
| Druglikeness | -0.45048 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64516 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide