| MolName | N,4-bis[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,2,4-triazol-3-amine |
| MolecularFormula | C24H28N8O2 |
| Smiles | C(COCC1)N1c1ccc(/C=N\Nc2nncn2/N=C\c(cc2)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H28N8O2/c1-5-22(30-9-13-33-14-10-30)6-2-20(1)17-25-28-24-29-26-19-32(24)27-18-21-3-7-23(8-4-21)31-11-15-34-16-12-31/h1-8,17-19H,9-16H2,(H,28,29) |
| InChIK | WBRGKJLIIPBGPM-UHFFFAOYSA-N |
| TotalMolweight | 460.54 |
| Molweight | 460.54 |
| MonoisotopicMass | 460.233522 |
| CLogP | 4.1171 |
| CLogS | -6.32 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 364.16 |
| Relative PSA | 0.24822 |
| PolarSurfaceArea | 92.4 |
| Druglikeness | 4.9075 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.67647 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 10 |
| Symmetricatoms | 8 |
| Amines | 2 |
| Aromatic Amines | 2 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N,4-bis[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,2,4-triazol-3-amine | 2 - N,4-bis[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,2,4-triazol-3-amine