| MolName | N-[(Z)-[4-bromo-2-[(4-chlorophenyl)methyl]pyrazol-3-yl]methylideneamino]-2-(2,5-dibromothiophen-3-yl)acetamide |
| MolecularFormula | C17H12N4OBr3ClS |
| Smiles | O=C(Cc(cc(s1)Br)c1Br)N/N=C\c(n(Cc(cc1)ccc1Cl)nc1)c1Br |
| InChI | InChI=1S/C17H12Br3ClN4OS/c18-13-7-23-25(9-10-1-3-12(21)4-2-10)14(13)8-22-24-16(26)6-11-5-15(19)27-17(11)20/h1-5,7-8H,6,9H2,(H,24,26) |
| InChIK | WBWCUOIAKWTAKM-UHFFFAOYSA-N |
| TotalMolweight | 595.54 |
| Molweight | 595.54 |
| MonoisotopicMass | 591.797041 |
| CLogP | 5.6489 |
| CLogS | -6.439 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 329.48 |
| Relative PSA | 0.22523 |
| PolarSurfaceArea | 87.52 |
| Druglikeness | 1.3681 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-bromo-2-[(4-chlorophenyl)methyl]pyrazol-3-yl]methylideneamino]-2-(2,5-dibromothiophen-3-yl)acetamide | 2 - N-[(Z)-[4-bromo-2-[(4-chlorophenyl)methyl]pyrazol-3-yl]methylideneamino]-2-(2,5-dibromothiophen-3-yl)acetamide