| MolName | N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| MolecularFormula | C27H23N5O4S2 |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(CSC(N2c3ccccc3)=Nc(sc3c4CCCC3)c4C2=O)=O)cccc1)=O |
| InChI | InChI=1S/C27H23N5O4S2/c33-23(30-28-16-8-10-18-9-4-6-14-21(18)32(35)36)17-37-27-29-25-24(20-13-5-7-15-22(20)38-25)26(34)31(27)19-11-2-1-3-12-19/h1-4,6,8-12,14,16H,5,7,13,15,17H2,(H,30,33) |
| InChIK | WBZHUJWKKAWOHT-UHFFFAOYSA-N |
| TotalMolweight | 545.643 |
| Molweight | 545.643 |
| MonoisotopicMass | 545.119145 |
| CLogP | 4.5202 |
| CLogS | -8.129 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 403.17 |
| Relative PSA | 0.32835 |
| PolarSurfaceArea | 173.49 |
| Druglikeness | -2.558 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide | 2 - N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide