| MolName | [(Z)-[1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]thiourea |
| MolecularFormula | C18H15N5Cl2S |
| Smiles | NC(N/N=C\c1cn(Cc(cc2)cc(Cl)c2Cl)nc1-c1ccccc1)=S |
| InChI | InChI=1S/C18H15Cl2N5S/c19-15-7-6-12(8-16(15)20)10-25-11-14(9-22-23-18(21)26)17(24-25)13-4-2-1-3-5-13/h1-9,11H,10H2,(H3,21,23,26) |
| InChIK | WCJMCOGCFXOIDL-UHFFFAOYSA-N |
| TotalMolweight | 404.324 |
| Molweight | 404.324 |
| MonoisotopicMass | 403.042519 |
| CLogP | 3.914 |
| CLogS | -5.705 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 302.79 |
| Relative PSA | 0.27768 |
| PolarSurfaceArea | 100.32 |
| Druglikeness | 4.677 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]thiourea | 2 - [(Z)-[1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]thiourea