| MolName | N'-[(Z)-naphthalen-1-ylmethylideneamino]-N-(pyridin-3-ylmethyl)oxamide |
| MolecularFormula | C19H16N4O2 |
| Smiles | O=C(C(N/N=C\c1cccc2ccccc12)=O)NCc1cnccc1 |
| InChI | InChI=1S/C19H16N4O2/c24-18(21-12-14-5-4-10-20-11-14)19(25)23-22-13-16-8-3-7-15-6-1-2-9-17(15)16/h1-11,13H,12H2,(H,21,24)(H,23,25) |
| InChIK | WCJPZXGXVZOTFX-UHFFFAOYSA-N |
| TotalMolweight | 332.362 |
| Molweight | 332.362 |
| MonoisotopicMass | 332.127326 |
| CLogP | 2.0468 |
| CLogS | -4.152 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 263.32 |
| Relative PSA | 0.27146 |
| PolarSurfaceArea | 83.45 |
| Druglikeness | 4.0479 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-naphthalen-1-ylmethylideneamino]-N-(pyridin-3-ylmethyl)oxamide | 2 - N'-[(Z)-naphthalen-1-ylmethylideneamino]-N-(pyridin-3-ylmethyl)oxamide