| MolName | N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-2-thiophen-2-ylacetamide |
| MolecularFormula | C16H14N2O3S |
| Smiles | O=C(Cc1cccs1)N/N=C\C=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C16H14N2O3S/c19-16(10-13-4-2-8-22-13)18-17-7-1-3-12-5-6-14-15(9-12)21-11-20-14/h1-9H,10-11H2,(H,18,19) |
| InChIK | WCORGBAVSQZZRG-UHFFFAOYSA-N |
| TotalMolweight | 314.364 |
| Molweight | 314.364 |
| MonoisotopicMass | 314.072513 |
| CLogP | 3.196 |
| CLogS | -4.699 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 243.45 |
| Relative PSA | 0.3137 |
| PolarSurfaceArea | 88.16 |
| Druglikeness | 6.0705 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-2-thiophen-2-ylacetamide | 2 - N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-2-thiophen-2-ylacetamide