| MolName | N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]benzamide |
| MolecularFormula | C18H13N2O2Cl |
| Smiles | O=C(c1ccccc1)N/N=C\c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C18H13ClN2O2/c19-15-8-4-7-14(11-15)17-10-9-16(23-17)12-20-21-18(22)13-5-2-1-3-6-13/h1-12H,(H,21,22) |
| InChIK | WDAYYCHJWUHGLY-UHFFFAOYSA-N |
| TotalMolweight | 324.766 |
| Molweight | 324.766 |
| MonoisotopicMass | 324.066555 |
| CLogP | 4.7465 |
| CLogS | -5.917 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 251.86 |
| Relative PSA | 0.199 |
| PolarSurfaceArea | 54.6 |
| Druglikeness | 6.4937 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]benzamide | 2 - N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]benzamide