| MolName | (Z)-1-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-morpholin-4-ylmethanimine |
| MolecularFormula | C22H20N4O2 |
| Smiles | C(COCC1)N1/N=C\c1cn(-c2ccccc2)nc1-c1cc(cccc2)c2o1 |
| InChI | InChI=1S/C22H20N4O2/c1-2-7-19(8-3-1)26-16-18(15-23-25-10-12-27-13-11-25)22(24-26)21-14-17-6-4-5-9-20(17)28-21/h1-9,14-16H,10-13H2 |
| InChIK | WDBQAPVWYVXBPB-UHFFFAOYSA-N |
| TotalMolweight | 372.427 |
| Molweight | 372.427 |
| MonoisotopicMass | 372.158626 |
| CLogP | 2.9531 |
| CLogS | -4.195 |
| H Acceptors | 6 |
| TotalSurfaceArea | 291.63 |
| Relative PSA | 0.19549 |
| PolarSurfaceArea | 55.79 |
| Druglikeness | 3.4081 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-morpholin-4-ylmethanimine | 2 - (Z)-1-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-morpholin-4-ylmethanimine