| MolName | 3-(2,4-dichlorophenyl)-4-[(Z)-(3-phenoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C21H14N4OCl2S |
| Smiles | S=C(NN=C1c(ccc(Cl)c2)c2Cl)N1/N=C\c1cc(Oc2ccccc2)ccc1 |
| InChI | InChI=1S/C21H14Cl2N4OS/c22-15-9-10-18(19(23)12-15)20-25-26-21(29)27(20)24-13-14-5-4-8-17(11-14)28-16-6-2-1-3-7-16/h1-13H,(H,26,29) |
| InChIK | WDDKZGKEVYQYHL-UHFFFAOYSA-N |
| TotalMolweight | 441.341 |
| Molweight | 441.341 |
| MonoisotopicMass | 440.026535 |
| CLogP | 5.9026 |
| CLogS | -8.22 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 322.32 |
| Relative PSA | 0.23588 |
| PolarSurfaceArea | 81.31 |
| Druglikeness | 3.4665 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.58621 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2,4-dichlorophenyl)-4-[(Z)-(3-phenoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2,4-dichlorophenyl)-4-[(Z)-(3-phenoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione