| MolName | N-[(Z)-naphthalen-1-ylmethylideneamino]-2H-tetrazol-5-amine |
| MolecularFormula | C12H10N6 |
| Smiles | C(c1cccc2ccccc12)=N\Nc1n[nH]nn1 |
| InChI | InChI=1S/C12H10N6/c1-2-7-11-9(4-1)5-3-6-10(11)8-13-14-12-15-17-18-16-12/h1-8H,(H2,14,15,16,17,18) |
| InChIK | WDHRQFOMBPEJNN-UHFFFAOYSA-N |
| TotalMolweight | 238.253 |
| Molweight | 238.253 |
| MonoisotopicMass | 238.096694 |
| CLogP | 4.0282 |
| CLogS | -4.163 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 189.69 |
| Relative PSA | 0.36834 |
| PolarSurfaceArea | 78.85 |
| Druglikeness | -1.4144 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-naphthalen-1-ylmethylideneamino]-2H-tetrazol-5-amine | 2 - N-[(Z)-naphthalen-1-ylmethylideneamino]-2H-tetrazol-5-amine