| MolName | 2,4-difluoro-N-[(Z)-indeno[2,1-b]chromen-6-ylmethylideneamino]aniline |
| MolecularFormula | C23H14N2OF2 |
| Smiles | Fc(cc1)cc(F)c1N/N=C\C1=C2Oc(cccc3)c3C=C2c2c1cccc2 |
| InChI | InChI=1S/C23H14F2N2O/c24-15-9-10-21(20(25)12-15)27-26-13-19-17-7-3-2-6-16(17)18-11-14-5-1-4-8-22(14)28-23(18)19/h1-13,27H |
| InChIK | WEAKIJXSXYCQAF-UHFFFAOYSA-N |
| TotalMolweight | 372.373 |
| Molweight | 372.373 |
| MonoisotopicMass | 372.107419 |
| CLogP | 5.9686 |
| CLogS | -5.511 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 272.33 |
| Relative PSA | 0.12107 |
| PolarSurfaceArea | 33.62 |
| Druglikeness | 1.0687 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-difluoro-N-[(Z)-indeno[2,1-b]chromen-6-ylmethylideneamino]aniline | 2 - 2,4-difluoro-N-[(Z)-indeno[2,1-b]chromen-6-ylmethylideneamino]aniline