| MolName | 2-cyano-N-[(Z)-(5-pyridin-2-ylsulfanylfuran-2-yl)methylideneamino]acetamide |
| MolecularFormula | C13H10N4O2S |
| Smiles | N#CCC(N/N=C\c(o1)ccc1Sc1ncccc1)=O |
| InChI | InChI=1S/C13H10N4O2S/c14-7-6-11(18)17-16-9-10-4-5-13(19-10)20-12-3-1-2-8-15-12/h1-5,8-9H,6H2,(H,17,18) |
| InChIK | WELHDIDHIQGETF-UHFFFAOYSA-N |
| TotalMolweight | 286.314 |
| Molweight | 286.314 |
| MonoisotopicMass | 286.052446 |
| CLogP | 1.6615 |
| CLogS | -3.168 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 228.4 |
| Relative PSA | 0.40342 |
| PolarSurfaceArea | 116.58 |
| Druglikeness | -0.55248 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-cyano-N-[(Z)-(5-pyridin-2-ylsulfanylfuran-2-yl)methylideneamino]acetamide | 2 - 2-cyano-N-[(Z)-(5-pyridin-2-ylsulfanylfuran-2-yl)methylideneamino]acetamide