| MolName | [4-bromo-2-[(Z)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C23H16N3O4BrClI |
| Smiles | O=C(CNC(c(cccc1)c1I)=O)N/N=C\c(cc(cc1)Br)c1OC(c(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C23H16BrClIN3O4/c24-16-7-10-20(33-23(32)14-5-8-17(25)9-6-14)15(11-16)12-28-29-21(30)13-27-22(31)18-3-1-2-4-19(18)26/h1-12H,13H2,(H,27,31)(H,29,30) |
| InChIK | WENXHAXCYNUEQN-UHFFFAOYSA-N |
| TotalMolweight | 640.654 |
| Molweight | 640.654 |
| MonoisotopicMass | 638.905743 |
| CLogP | 5.4841 |
| CLogS | -7.544 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 377.8 |
| Relative PSA | 0.22115 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 3.7292 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60606 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [4-bromo-2-[(Z)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate