| MolName | N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]pyridine-3-carboxamide |
| MolecularFormula | C23H24N4O2 |
| Smiles | O=C(c1cnccc1)N/N=C\C(CC/C1=C/c2ccccc2)=C1N1CCOCC1 |
| InChI | InChI=1S/C23H24N4O2/c28-23(21-7-4-10-24-16-21)26-25-17-20-9-8-19(15-18-5-2-1-3-6-18)22(20)27-11-13-29-14-12-27/h1-7,10,15-17H,8-9,11-14H2,(H,26,28) |
| InChIK | WEVAQUFITMRIKZ-UHFFFAOYSA-N |
| TotalMolweight | 388.47 |
| Molweight | 388.47 |
| MonoisotopicMass | 388.189926 |
| CLogP | 2.7802 |
| CLogS | -3.492 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 309.24 |
| Relative PSA | 0.19574 |
| PolarSurfaceArea | 66.82 |
| Druglikeness | 4.6644 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]pyridine-3-carboxamide | 2 - N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]pyridine-3-carboxamide