| MolName | (Z)-1-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-N-[(Z)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]methanimine |
| MolecularFormula | C24H12N2O2Cl2F6 |
| Smiles | FC(c(cc1)cc(-c2ccc(/C=N\N=C/c3ccc(-c(cc(C(F)(F)F)cc4)c4Cl)o3)o2)c1Cl)(F)F |
| InChI | InChI=1S/C24H12Cl2F6N2O2/c25-19-5-1-13(23(27,28)29)9-17(19)21-7-3-15(35-21)11-33-34-12-16-4-8-22(36-16)18-10-14(24(30,31)32)2-6-20(18)26/h1-12H |
| InChIK | WEVKUUJHHZRWLB-UHFFFAOYSA-N |
| TotalMolweight | 545.265 |
| Molweight | 545.265 |
| MonoisotopicMass | 544.018 |
| CLogP | 9.572 |
| CLogS | -10.08 |
| H Acceptors | 4 |
| TotalSurfaceArea | 371.2 |
| Relative PSA | 0.13804 |
| PolarSurfaceArea | 51 |
| Druglikeness | -3.2829 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 20 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-N-[(Z)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]methanimine | 2 - (Z)-1-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-N-[(Z)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]methanimine