| MolName | 1-[(Z)-[(3Z)-3-benzylidene-2-piperidin-1-ylcyclopenten-1-yl]methylideneamino]-3-phenylthiourea |
| MolecularFormula | C25H28N4S |
| Smiles | S=C(Nc1ccccc1)N/N=C\C(CC/C1=C/c2ccccc2)=C1N1CCCCC1 |
| InChI | InChI=1S/C25H28N4S/c30-25(27-23-12-6-2-7-13-23)28-26-19-22-15-14-21(18-20-10-4-1-5-11-20)24(22)29-16-8-3-9-17-29/h1-2,4-7,10-13,18-19H,3,8-9,14-17H2,(H2,27,28,30) |
| InChIK | WFBIXHFBKGMMCR-UHFFFAOYSA-N |
| TotalMolweight | 416.591 |
| Molweight | 416.591 |
| MonoisotopicMass | 416.203466 |
| CLogP | 5.3357 |
| CLogS | -5.776 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 340.66 |
| Relative PSA | 0.19368 |
| PolarSurfaceArea | 71.75 |
| Druglikeness | 3.539 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[(3Z)-3-benzylidene-2-piperidin-1-ylcyclopenten-1-yl]methylideneamino]-3-phenylthiourea | 2 - 1-[(Z)-[(3Z)-3-benzylidene-2-piperidin-1-ylcyclopenten-1-yl]methylideneamino]-3-phenylthiourea