| MolName | N-[(Z)-naphthalen-2-ylmethylideneamino]-4-phenylbenzamide |
| MolecularFormula | C24H18N2O |
| Smiles | O=C(c(cc1)ccc1-c1ccccc1)N/N=C\c1cc2ccccc2cc1 |
| InChI | InChI=1S/C24H18N2O/c27-24(22-14-12-21(13-15-22)19-6-2-1-3-7-19)26-25-17-18-10-11-20-8-4-5-9-23(20)16-18/h1-17H,(H,26,27) |
| InChIK | WFEBNHCRWGXELH-UHFFFAOYSA-N |
| TotalMolweight | 350.42 |
| Molweight | 350.42 |
| MonoisotopicMass | 350.141913 |
| CLogP | 6.0552 |
| CLogS | -7.413 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 281.35 |
| Relative PSA | 0.12799 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 4.4687 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-naphthalen-2-ylmethylideneamino]-4-phenylbenzamide | 2 - N-[(Z)-naphthalen-2-ylmethylideneamino]-4-phenylbenzamide