| MolName | (Z)-N-(benzimidazol-1-yl)-1-(2-fluorophenyl)methanimine |
| MolecularFormula | C14H10N3F |
| Smiles | Fc1c(/C=N\n2c(cccc3)c3nc2)cccc1 |
| InChI | InChI=1S/C14H10FN3/c15-12-6-2-1-5-11(12)9-17-18-10-16-13-7-3-4-8-14(13)18/h1-10H |
| InChIK | WFIADNSZBLJGHN-UHFFFAOYSA-N |
| TotalMolweight | 239.252 |
| Molweight | 239.252 |
| MonoisotopicMass | 239.085875 |
| CLogP | 3.1588 |
| CLogS | -5.885 |
| H Acceptors | 3 |
| TotalSurfaceArea | 186.69 |
| Relative PSA | 0.15721 |
| PolarSurfaceArea | 30.18 |
| Druglikeness | 2.5306 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(benzimidazol-1-yl)-1-(2-fluorophenyl)methanimine | 2 - (Z)-N-(benzimidazol-1-yl)-1-(2-fluorophenyl)methanimine