| MolName | [4-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 2-fluorobenzoate |
| MolecularFormula | C21H14N3O5F |
| Smiles | [O-][N+](c1cccc(C(N/N=C\c(cc2)ccc2OC(c(cccc2)c2F)=O)=O)c1)=O |
| InChI | InChI=1S/C21H14FN3O5/c22-19-7-2-1-6-18(19)21(27)30-17-10-8-14(9-11-17)13-23-24-20(26)15-4-3-5-16(12-15)25(28)29/h1-13H,(H,24,26) |
| InChIK | WGKMQBIGLGOXDG-UHFFFAOYSA-N |
| TotalMolweight | 407.356 |
| Molweight | 407.356 |
| MonoisotopicMass | 407.09175 |
| CLogP | 3.8113 |
| CLogS | -5.965 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 304.52 |
| Relative PSA | 0.29381 |
| PolarSurfaceArea | 113.58 |
| Druglikeness | -2.4281 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 2-fluorobenzoate | 2 - [4-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 2-fluorobenzoate