| MolName | 1-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]tetrazol-5-amine |
| MolecularFormula | C12H8N7O3Cl |
| Smiles | Nc1nnnn1/N=C\c1ccc(-c(cc(cc2)[N+]([O-])=O)c2Cl)o1 |
| InChI | InChI=1S/C12H8ClN7O3/c13-10-3-1-7(20(21)22)5-9(10)11-4-2-8(23-11)6-15-19-12(14)16-17-18-19/h1-6H,(H2,14,16,18) |
| InChIK | WGMJWJGWALZZGT-UHFFFAOYSA-N |
| TotalMolweight | 333.695 |
| Molweight | 333.695 |
| MonoisotopicMass | 333.037715 |
| CLogP | 1.8498 |
| CLogS | -6.443 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 240.32 |
| Relative PSA | 0.46226 |
| PolarSurfaceArea | 140.94 |
| Druglikeness | -1.2725 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]tetrazol-5-amine | 2 - 1-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]tetrazol-5-amine