| MolName | N-[(Z)-(4-chlorophenyl)methylideneamino]-2-[[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-nitrosoamino]acetamide |
| MolecularFormula | C18H16N6O3Cl2 |
| Smiles | O=C(CN(CC(N/N=C\c(cc1)ccc1Cl)=O)N=O)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C18H16Cl2N6O3/c19-15-5-1-13(2-6-15)9-21-23-17(27)11-26(25-29)12-18(28)24-22-10-14-3-7-16(20)8-4-14/h1-10H,11-12H2,(H,23,27)(H,24,28) |
| InChIK | WHUAAKATOFVDKO-UHFFFAOYSA-N |
| TotalMolweight | 435.27 |
| Molweight | 435.27 |
| MonoisotopicMass | 434.066093 |
| CLogP | 3.4482 |
| CLogS | -5.008 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 327.42 |
| Relative PSA | 0.30578 |
| PolarSurfaceArea | 115.59 |
| Druglikeness | 5.0192 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | nitroso; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72414 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 15 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-[[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-nitrosoamino]acetamide | 2 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-[[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-nitrosoamino]acetamide