| MolName | 5-phenyl-N-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]thieno[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C24H15N4OF3S |
| Smiles | FC(c1cccc(-c2ccc(/C=N\Nc3c(c(-c4ccccc4)cs4)c4ncn3)o2)c1)(F)F |
| InChI | InChI=1S/C24H15F3N4OS/c25-24(26,27)17-8-4-7-16(11-17)20-10-9-18(32-20)12-30-31-22-21-19(15-5-2-1-3-6-15)13-33-23(21)29-14-28-22/h1-14H,(H,28,29,31) |
| InChIK | WHVCMQOWGQDBGF-UHFFFAOYSA-N |
| TotalMolweight | 464.47 |
| Molweight | 464.47 |
| MonoisotopicMass | 464.091865 |
| CLogP | 8.1109 |
| CLogS | -8.96 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 335.97 |
| Relative PSA | 0.23627 |
| PolarSurfaceArea | 91.55 |
| Druglikeness | -2.4125 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-phenyl-N-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]thieno[2,3-d]pyrimidin-4-amine | 2 - 5-phenyl-N-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]thieno[2,3-d]pyrimidin-4-amine