| MolName | [3-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| MolecularFormula | C29H21N3O6S |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C\c(cc1)cc2c1OCO2)N/N=C\c1cccc(OC(c2cccs2)=O)c1 |
| InChI | InChI=1S/C29H21N3O6S/c33-27(21-7-2-1-3-8-21)31-23(15-19-11-12-24-25(16-19)37-18-36-24)28(34)32-30-17-20-6-4-9-22(14-20)38-29(35)26-10-5-13-39-26/h1-17H,18H2,(H,31,33)(H,32,34) |
| InChIK | WIDBRQCTRZGPDG-UHFFFAOYSA-N |
| TotalMolweight | 539.567 |
| Molweight | 539.567 |
| MonoisotopicMass | 539.115107 |
| CLogP | 6.2268 |
| CLogS | -7.657 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 404.38 |
| Relative PSA | 0.30642 |
| PolarSurfaceArea | 143.56 |
| Druglikeness | 7.4841 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate | 2 - [3-[(Z)-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate