| MolName | N-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C29H33N8Cl |
| Smiles | Clc1c(Cn2c(cccc3)c3c(/C=N\Nc3nc(N4CCCCC4)nc(N4CCCCC4)n3)c2)cccc1 |
| InChI | InChI=1S/C29H33ClN8/c30-25-13-5-3-11-22(25)20-38-21-23(24-12-4-6-14-26(24)38)19-31-35-27-32-28(36-15-7-1-8-16-36)34-29(33-27)37-17-9-2-10-18-37/h3-6,11-14,19,21H,1-2,7-10,15-18,20H2,(H,32,33,34,35) |
| InChIK | WIJXBEYAJJSOAN-UHFFFAOYSA-N |
| TotalMolweight | 529.09 |
| Molweight | 529.09 |
| MonoisotopicMass | 528.251669 |
| CLogP | 8.0642 |
| CLogS | -7.033 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 409.46 |
| Relative PSA | 0.17059 |
| PolarSurfaceArea | 74.47 |
| Druglikeness | 3.0085 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.47368 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 11 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine