| MolName | (Z)-N-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-(2,6-dichlorophenyl)methanimine |
| MolecularFormula | C16H11N4Cl3S |
| Smiles | Clc1c(CSc2nncn2N=Cc(c(Cl)ccc2)c2Cl)cccc1 |
| InChI | InChI=1S/C16H11Cl3N4S/c17-13-5-2-1-4-11(13)9-24-16-22-20-10-23(16)21-8-12-14(18)6-3-7-15(12)19/h1-8,10H,9H2 |
| InChIK | WINZKNIAUDTSFT-UHFFFAOYSA-N |
| TotalMolweight | 397.716 |
| Molweight | 397.716 |
| MonoisotopicMass | 395.976997 |
| CLogP | 5.2498 |
| CLogS | -8.716 |
| H Acceptors | 4 |
| TotalSurfaceArea | 281.77 |
| Relative PSA | 0.20517 |
| PolarSurfaceArea | 68.37 |
| Druglikeness | 3.9939 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-(2,6-dichlorophenyl)methanimine | 2 - (Z)-N-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-(2,6-dichlorophenyl)methanimine