| MolName | (Z)-3-[(Z)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(4-fluorophenyl)-N-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazol-2-imine |
| MolecularFormula | C32H26N5O2FS |
| Smiles | Fc(cc1)ccc1C(N1/N=C\c2cn(-c3ccccc3)nc2-c2cc(cccc3)c3o2)=CS/C1=N/C[C@H]1OCCC1 |
| InChI | InChI=1S/C32H26FN5O2S/c33-25-14-12-22(13-15-25)28-21-41-32(34-19-27-10-6-16-39-27)38(28)35-18-24-20-37(26-8-2-1-3-9-26)36-31(24)30-17-23-7-4-5-11-29(23)40-30/h1-5,7-9,11-15,17-18,20-21,27H,6,10,16,19H2/t27-/m0/s1 |
| InChIK | WIXUKUAHAKMCMC-MHZLTWQESA-N |
| TotalMolweight | 563.655 |
| Molweight | 563.655 |
| MonoisotopicMass | 563.179123 |
| CLogP | 5.9122 |
| CLogS | -7.835 |
| H Acceptors | 7 |
| TotalSurfaceArea | 421.91 |
| Relative PSA | 0.20386 |
| PolarSurfaceArea | 93.45 |
| Druglikeness | 1.945 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.39024 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 1 |
| Rotatable Bond | 7 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (Z)-3-[(Z)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(4-fluorophenyl)-N-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazol-2-imine | 2 - (Z)-3-[(Z)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(4-fluorophenyl)-N-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazol-2-imine