| MolName | (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-1-phenylethanone |
| MolecularFormula | C14H11N2OCl |
| Smiles | O=C(/C=N\Nc(cc1)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H11ClN2O/c15-12-6-8-13(9-7-12)17-16-10-14(18)11-4-2-1-3-5-11/h1-10,17H |
| InChIK | WJGVUDNBBYSPTK-UHFFFAOYSA-N |
| TotalMolweight | 258.707 |
| Molweight | 258.707 |
| MonoisotopicMass | 258.05599 |
| CLogP | 4.2458 |
| CLogS | -3.953 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 202.41 |
| Relative PSA | 0.17791 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 2.5475 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.72222 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-1-phenylethanone | 2 - (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-1-phenylethanone