| MolName | N-[(Z)-(3-hydroxyphenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| MolecularFormula | C11H10N6O4 |
| Smiles | [O-][N+](c1nn(CC(N/N=C\c2cc(O)ccc2)=O)cn1)=O |
| InChI | InChI=1S/C11H10N6O4/c18-9-3-1-2-8(4-9)5-13-14-10(19)6-16-7-12-11(15-16)17(20)21/h1-5,7,18H,6H2,(H,14,19) |
| InChIK | WJIKNVUHUQNDAZ-UHFFFAOYSA-N |
| TotalMolweight | 290.238 |
| Molweight | 290.238 |
| MonoisotopicMass | 290.076354 |
| CLogP | -0.263 |
| CLogS | -2.767 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 217.49 |
| Relative PSA | 0.49814 |
| PolarSurfaceArea | 138.22 |
| Druglikeness | 1.3279 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide | 2 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide