| MolName | N-[(Z)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C20H17N2O3ClS |
| Smiles | O=S(c1ccccc1)(N/N=C\c(cc1)cc(Cl)c1OCc1ccccc1)=O |
| InChI | InChI=1S/C20H17ClN2O3S/c21-19-13-17(11-12-20(19)26-15-16-7-3-1-4-8-16)14-22-23-27(24,25)18-9-5-2-6-10-18/h1-14,23H,15H2 |
| InChIK | WKCFZIKZOQXYMO-UHFFFAOYSA-N |
| TotalMolweight | 400.885 |
| Molweight | 400.885 |
| MonoisotopicMass | 400.06484 |
| CLogP | 4.2312 |
| CLogS | -3.993 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 296.76 |
| Relative PSA | 0.20741 |
| PolarSurfaceArea | 76.14 |
| Druglikeness | -8.1667 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide | 2 - N-[(Z)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide