| MolName | (Z)-1-(4-chloro-3-nitrophenyl)-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]methanimine |
| MolecularFormula | C14H8N4O4Cl2 |
| Smiles | [O-][N+](c(cc(/C=N\N=C/c(cc1)cc([N+]([O-])=O)c1Cl)cc1)c1Cl)=O |
| InChI | InChI=1S/C14H8Cl2N4O4/c15-11-3-1-9(5-13(11)19(21)22)7-17-18-8-10-2-4-12(16)14(6-10)20(23)24/h1-8H |
| InChIK | WKGOGDOCHRBPHW-UHFFFAOYSA-N |
| TotalMolweight | 367.148 |
| Molweight | 367.148 |
| MonoisotopicMass | 365.99226 |
| CLogP | 4.1544 |
| CLogS | -6.524 |
| H Acceptors | 8 |
| TotalSurfaceArea | 260.72 |
| Relative PSA | 0.32165 |
| PolarSurfaceArea | 116.36 |
| Druglikeness | -3.7843 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 12 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-chloro-3-nitrophenyl)-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]methanimine | 2 - (Z)-1-(4-chloro-3-nitrophenyl)-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]methanimine