| MolName | N-[(E)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C24H27N8O3Cl |
| Smiles | [O-][N+](c(cc1)cc(Cl)c1-c1ccc(/C=N/Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)o1)=O |
| InChI | InChI=1S/C24H27ClN8O3/c25-20-15-17(33(34)35)7-9-19(20)21-10-8-18(36-21)16-26-30-22-27-23(31-11-3-1-4-12-31)29-24(28-22)32-13-5-2-6-14-32/h7-10,15-16H,1-6,11-14H2,(H,27,28,29,30) |
| InChIK | WLLBJROJKURDJV-UHFFFAOYSA-N |
| TotalMolweight | 510.984 |
| Molweight | 510.984 |
| MonoisotopicMass | 510.189464 |
| CLogP | 6.0406 |
| CLogS | -7.975 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 385.26 |
| Relative PSA | 0.27906 |
| PolarSurfaceArea | 128.5 |
| Druglikeness | -0.76526 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 11 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(E)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine