| MolName | 2-(2-nitrophenoxy)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C22H19N3O5 |
| Smiles | [O-][N+](c(cccc1)c1OCC(N/N=C\c1cc(OCc2ccccc2)ccc1)=O)=O |
| InChI | InChI=1S/C22H19N3O5/c26-22(16-30-21-12-5-4-11-20(21)25(27)28)24-23-14-18-9-6-10-19(13-18)29-15-17-7-2-1-3-8-17/h1-14H,15-16H2,(H,24,26) |
| InChIK | WLLRTBOXHVBVJF-UHFFFAOYSA-N |
| TotalMolweight | 405.409 |
| Molweight | 405.409 |
| MonoisotopicMass | 405.132472 |
| CLogP | 3.203 |
| CLogS | -5.302 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 317.94 |
| Relative PSA | 0.27184 |
| PolarSurfaceArea | 105.74 |
| Druglikeness | -0.93238 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-nitrophenoxy)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - 2-(2-nitrophenoxy)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide