| MolName | 2-[(4-bromophenyl)methylsulfanyl]-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]acetamide |
| MolecularFormula | C14H12N2O2BrIS |
| Smiles | O=C(CSCc(cc1)ccc1Br)N/N=C\c(o1)ccc1I |
| InChI | InChI=1S/C14H12BrIN2O2S/c15-11-3-1-10(2-4-11)8-21-9-14(19)18-17-7-12-5-6-13(16)20-12/h1-7H,8-9H2,(H,18,19) |
| InChIK | WLYQRQIHSQTZNW-UHFFFAOYSA-N |
| TotalMolweight | 479.131 |
| Molweight | 479.131 |
| MonoisotopicMass | 477.884757 |
| CLogP | 3.8396 |
| CLogS | -5.802 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 266.6 |
| Relative PSA | 0.2536 |
| PolarSurfaceArea | 79.9 |
| Druglikeness | 5.3284 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7619 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(4-bromophenyl)methylsulfanyl]-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]acetamide | 2 - 2-[(4-bromophenyl)methylsulfanyl]-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]acetamide