| MolName | N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]naphthalene-2-carboxamide |
| MolecularFormula | C25H20N2O2 |
| Smiles | O=C(c1cc2ccccc2cc1)N/N=C\c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H20N2O2/c28-25(23-13-12-21-8-4-5-9-22(21)16-23)27-26-17-19-10-14-24(15-11-19)29-18-20-6-2-1-3-7-20/h1-17H,18H2,(H,27,28) |
| InChIK | WLYRLZQNNKJKDD-UHFFFAOYSA-N |
| TotalMolweight | 380.446 |
| Molweight | 380.446 |
| MonoisotopicMass | 380.152478 |
| CLogP | 5.7441 |
| CLogS | -6.668 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 305.11 |
| Relative PSA | 0.1508 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 4.0205 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]naphthalene-2-carboxamide | 2 - N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]naphthalene-2-carboxamide