| MolName | N'-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)oxamide |
| MolecularFormula | C29H23N4O3BrS |
| Smiles | N#Cc1c(NC(C(N/N=C\c(c2ccccc2cc2)c2OCc2cccc(Br)c2)=O)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C29H23BrN4O3S/c30-20-8-5-6-18(14-20)17-37-25-13-12-19-7-1-2-9-21(19)24(25)16-32-34-28(36)27(35)33-29-23(15-31)22-10-3-4-11-26(22)38-29/h1-2,5-9,12-14,16H,3-4,10-11,17H2,(H,33,35)(H,34,36) |
| InChIK | WMGWPMGUYJZOPT-UHFFFAOYSA-N |
| TotalMolweight | 587.497 |
| Molweight | 587.497 |
| MonoisotopicMass | 586.067422 |
| CLogP | 6.4602 |
| CLogS | -9.331 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 412.14 |
| Relative PSA | 0.25338 |
| PolarSurfaceArea | 131.82 |
| Druglikeness | -6.3215 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)oxamide | 2 - N'-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)oxamide