| MolName | 2-(4-phenylmethoxyphenoxy)-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C29H26N2O4 |
| Smiles | O=C(COc(cc1)ccc1OCc1ccccc1)N/N=C/c(cccc1)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H26N2O4/c32-29(22-34-27-17-15-26(16-18-27)33-20-23-9-3-1-4-10-23)31-30-19-25-13-7-8-14-28(25)35-21-24-11-5-2-6-12-24/h1-19H,20-22H2,(H,31,32) |
| InChIK | WMZUUBQOVJFAKT-UHFFFAOYSA-N |
| TotalMolweight | 466.535 |
| Molweight | 466.535 |
| MonoisotopicMass | 466.189258 |
| CLogP | 5.4727 |
| CLogS | -6.183 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 377.79 |
| Relative PSA | 0.17473 |
| PolarSurfaceArea | 69.15 |
| Druglikeness | 4.1966 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 11 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-phenylmethoxyphenoxy)-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - 2-(4-phenylmethoxyphenoxy)-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]acetamide