| MolName | 2-(2-fluorophenoxy)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]acetamide |
| MolecularFormula | C13H10N3O5F |
| Smiles | [O-][N+](c1ccc(/C=N\NC(COc(cccc2)c2F)=O)o1)=O |
| InChI | InChI=1S/C13H10FN3O5/c14-10-3-1-2-4-11(10)21-8-12(18)16-15-7-9-5-6-13(22-9)17(19)20/h1-7H,8H2,(H,16,18) |
| InChIK | WNCNETGZLOCRRP-UHFFFAOYSA-N |
| TotalMolweight | 307.236 |
| Molweight | 307.236 |
| MonoisotopicMass | 307.06045 |
| CLogP | 1.4958 |
| CLogS | -4.482 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 230.46 |
| Relative PSA | 0.39287 |
| PolarSurfaceArea | 109.65 |
| Druglikeness | 1.6697 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-fluorophenoxy)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]acetamide | 2 - 2-(2-fluorophenoxy)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]acetamide