2-[4-[(Z)-[[2-(4-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid
Formula:C17H14N3O5F
Mutagenic:none
Tumorigenic:none
Reproductive Effective:none
2-[4-[(Z)-[[2-(4-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid is a drug-like molecule.
| MolName | 2-[4-[(Z)-[[2-(4-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C17H14N3O5F |
| Smiles | OC(COc1ccc(/C=N\NC(C(Nc(cc2)ccc2F)=O)=O)cc1)=O |
| InChI | InChI=1S/C17H14FN3O5/c18-12-3-5-13(6-4-12)20-16(24)17(25)21-19-9-11-1-7-14(8-2-11)26-10-15(22)23/h1-9H,10H2,(H,20,24)(H,21,25)(H,22,23) |
| InChIK | WNNPKGYSZXKXLQ-UHFFFAOYSA-N |
| TotalMolweight | 359.312 |
| Molweight | 359.312 |
| MonoisotopicMass | 359.09175 |
| CLogP | 1.3047 |
| CLogS | -3.632 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 270.41 |
| Relative PSA | 0.35742 |
| PolarSurfaceArea | 117.09 |
| Druglikeness | 2.2195 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.73077 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[[2-(4-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[4-[(Z)-[[2-(4-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid
Spacefill |
Wire |
Ball & Stick |
Iso-vdw |
Opaque |
Dot Surface |
Mep |
Translucent |
Spin |
Label On |
Off