| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(phenoxymethyl)-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C26H22N8O4 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)ccc2OCc2ccccc2)=O)c1COc1ccccc1 |
| InChI | InChI=1S/C26H22N8O4/c27-24-25(32-38-31-24)34-22(17-37-20-9-5-2-6-10-20)23(29-33-34)26(35)30-28-15-18-11-13-21(14-12-18)36-16-19-7-3-1-4-8-19/h1-15H,16-17H2,(H2,27,31)(H,30,35) |
| InChIK | WNRDVNWUALHSKK-UHFFFAOYSA-N |
| TotalMolweight | 510.513 |
| Molweight | 510.513 |
| MonoisotopicMass | 510.176402 |
| CLogP | 4.4456 |
| CLogS | -4.134 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 396.24 |
| Relative PSA | 0.34358 |
| PolarSurfaceArea | 155.57 |
| Druglikeness | 1.7208 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(phenoxymethyl)-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(phenoxymethyl)-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]triazole-4-carboxamide