| MolName | 3,5-dibromo-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C14H8N2O2Br2Cl2 |
| Smiles | Oc(c(C(N/N=C\c(ccc(Cl)c1)c1Cl)=O)cc(Br)c1)c1Br |
| InChI | InChI=1S/C14H8Br2Cl2N2O2/c15-8-3-10(13(21)11(16)4-8)14(22)20-19-6-7-1-2-9(17)5-12(7)18/h1-6,21H,(H,20,22) |
| InChIK | WNWQFWCSLVRBBA-UHFFFAOYSA-N |
| TotalMolweight | 466.944 |
| Molweight | 466.944 |
| MonoisotopicMass | 463.832954 |
| CLogP | 5.5183 |
| CLogS | -6.565 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 261.44 |
| Relative PSA | 0.18784 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 2.6398 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3,5-dibromo-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-hydroxybenzamide | 2 - 3,5-dibromo-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-hydroxybenzamide