2-[2-iodo-4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]acetic acid
Formula:C14H11N2O4IS
Mutagenic:none
Tumorigenic:none
Reproductive Effective:none
2-[2-iodo-4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]acetic acid is a drug-like molecule.
| MolName | 2-[2-iodo-4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]acetic acid |
| MolecularFormula | C14H11N2O4IS |
| Smiles | OC(COc(ccc(/C=N\NC(c1cccs1)=O)c1)c1I)=O |
| InChI | InChI=1S/C14H11IN2O4S/c15-10-6-9(3-4-11(10)21-8-13(18)19)7-16-17-14(20)12-2-1-5-22-12/h1-7H,8H2,(H,17,20)(H,18,19) |
| InChIK | WOIFRPYKUNJSIU-UHFFFAOYSA-N |
| TotalMolweight | 430.217 |
| Molweight | 430.217 |
| MonoisotopicMass | 429.948426 |
| CLogP | 2.5653 |
| CLogS | -4.54 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 257.07 |
| Relative PSA | 0.35986 |
| PolarSurfaceArea | 116.23 |
| Druglikeness | 6.5275 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-iodo-4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]acetic acid | 2 - 2-[2-iodo-4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]acetic acid
Spacefill |
Wire |
Ball & Stick |
Iso-vdw |
Opaque |
Dot Surface |
Mep |
Translucent |
Spin |
Label On |
Off