| MolName | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-bromophenyl)methylideneamino]acetamide |
| MolecularFormula | C23H16N5OBrCl2S |
| Smiles | O=C(CSc1nnc(-c(cc2)ccc2Cl)n1-c(cc1)ccc1Cl)N/N=C\c(cc1)ccc1Br |
| InChI | InChI=1S/C23H16BrCl2N5OS/c24-17-5-1-15(2-6-17)13-27-28-21(32)14-33-23-30-29-22(16-3-7-18(25)8-4-16)31(23)20-11-9-19(26)10-12-20/h1-13H,14H2,(H,28,32) |
| InChIK | WOPFMBDGCIOWOH-UHFFFAOYSA-N |
| TotalMolweight | 561.29 |
| Molweight | 561.29 |
| MonoisotopicMass | 558.963595 |
| CLogP | 6.469 |
| CLogS | -10.722 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 373.95 |
| Relative PSA | 0.22011 |
| PolarSurfaceArea | 97.47 |
| Druglikeness | 3.6589 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-bromophenyl)methylideneamino]acetamide | 2 - 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-bromophenyl)methylideneamino]acetamide